C31H32O10 — CID 163101093
(2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4,5-dihydroxyphenyl]oct-2-enoyl]oxypropanoic acid (PubChem CID 163101093) has the molecular formula C31H32O10 and a molecular weight of 564.59 g/mol. Its IUPAC name is (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4,5-dihydroxyphenyl]oct-2-enoyl]oxypropanoic acid.
| Compound Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4,5-dihydroxyphenyl]oct-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 163101093 |
| Molecular Formula | C31H32O10 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4,5-dihydroxyphenyl]oct-2-enoyl]oxypropanoic acid |
| SMILES | CCCCC/C(=C\C(=O)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O)c1cc(O)c(O)cc1/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C31H32O10/c1-2-3-4-5-20(16-30(38)41-29(31(39)40)14-19-8-11-24(33)26(35)13-19)22-17-28(37)27(36)15-21(22)9-6-18-7-10-23(32)25(34)12-18/h6-13,15-17,29,32-37H,2-5,14H2,1H3,(H,39,40)/b9-6+,20-16+/t29-/m1/s1 |
| InChIKey | LNFZTVRWONVEBG-IVZLJVOBSA-N |
| XLogP | 5.29 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|