C36H33NO11 — CID 163071143
(2R,3R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid (PubChem CID 163071143) has the molecular formula C36H33NO11 and a molecular weight of 655.66 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid.
| Compound Name | (2R,3R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 163071143 |
| Molecular Formula | C36H33NO11 |
| Molecular Weight | 655.66 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | (2R,3R)-2-[(E)-3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)-4-(methylamino)butanoic acid |
| SMILES | CNC[C@@H](c1ccc(O)c(O)c1)[C@@H](OC(=O)/C=C/c1cc(O)c(O)c2c1C=C(c1cc(O)c(O)cc1-c1cccc(O)c1)CC2)C(=O)O |
| InChI | InChI=1S/C36H33NO11/c1-37-17-27(21-6-9-28(39)29(40)13-21)35(36(46)47)48-33(44)10-7-20-14-32(43)34(45)23-8-5-19(12-24(20)23)26-16-31(42)30(41)15-25(26)18-3-2-4-22(38)11-18/h2-4,6-7,9-16,27,35,37-43,45H,5,8,17H2,1H3,(H,46,47)/b10-7+/t27-,35+/m0/s1 |
| InChIKey | DXSPISSWYHKBGE-LGKAEIEISA-N |
| XLogP | 4.79 |
| TPSA | 217.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|