C37H35NO12 — CID 162828266
2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyloxy]-4-(ethylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid (PubChem CID 162828266) has the molecular formula C37H35NO12 and a molecular weight of 685.68 g/mol. Its IUPAC name is 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyloxy]-4-(ethylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid.
| Compound Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyloxy]-4-(ethylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 162828266 |
| Molecular Formula | C37H35NO12 |
| Molecular Weight | 685.68 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | 2-[3-[7-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]-3,4-dihydroxy-5,6-dihydronaphthalen-1-yl]prop-2-enoyloxy]-4-(ethylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid |
| SMILES | CCNCC(c1cc(O)c(O)c(O)c1)C(OC(=O)C=Cc1cc(O)c(O)c2c1C=C(c1cc(O)c(O)cc1-c1cccc(O)c1)CC2)C(=O)O |
| InChI | InChI=1S/C37H35NO12/c1-2-38-17-27(21-13-31(43)35(47)32(44)14-21)36(37(48)49)50-33(45)9-7-20-12-30(42)34(46)23-8-6-19(11-24(20)23)26-16-29(41)28(40)15-25(26)18-4-3-5-22(39)10-18/h3-5,7,9-16,27,36,38-44,46-47H,2,6,8,17H2,1H3,(H,48,49) |
| InChIKey | PSQCFQSDVBVCAA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 237.47 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|