C19H19FO4 — CID 7485551
(4,5-dimethoxy-2-methylphenyl)methyl (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7485551) has the molecular formula C19H19FO4 and a molecular weight of 330.36 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7485551 |
| Molecular Formula | C19H19FO4 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | COc1cc(C)c(COC(=O)/C=C/c2ccccc2F)cc1OC |
| InChI | InChI=1S/C19H19FO4/c1-13-10-17(22-2)18(23-3)11-15(13)12-24-19(21)9-8-14-6-4-5-7-16(14)20/h4-11H,12H2,1-3H3/b9-8+ |
| InChIKey | UCEKTJYHSIMBBW-CMDGGOBGSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|