C18H11ClNO4- — CID 135749986
4-[(E)-2-(4-carboxyquinolin-2-yl)ethenyl]-2-chloro-6-hydroxyphenolate (PubChem CID 135749986) has the molecular formula C18H11ClNO4- and a molecular weight of 340.74 g/mol. Its IUPAC name is 4-[(E)-2-(4-carboxyquinolin-2-yl)ethenyl]-2-chloro-6-hydroxyphenolate.
| Compound Name | 4-[(E)-2-(4-carboxyquinolin-2-yl)ethenyl]-2-chloro-6-hydroxyphenolate |
|---|---|
| PubChem CID | 135749986 |
| Molecular Formula | C18H11ClNO4- |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-[(E)-2-(4-carboxyquinolin-2-yl)ethenyl]-2-chloro-6-hydroxyphenolate |
| SMILES | O=C(O)c1cc(/C=C/c2cc(O)c([O-])c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C18H12ClNO4/c19-14-7-10(8-16(21)17(14)22)5-6-11-9-13(18(23)24)12-3-1-2-4-15(12)20-11/h1-9,21-22H,(H,23,24)/p-1/b6-5+ |
| InChIKey | QZZMCNVCNTUHQO-AATRIKPKSA-M |
| XLogP | 3.54 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |