C41H35F6N3 — CID 20724556
4-[(1E,3E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 20724556) has the molecular formula C41H35F6N3 and a molecular weight of 683.74 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 20724556 |
| Molecular Formula | C41H35F6N3 |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 4-[(1E,3E)-4-[3-[3,5-bis(trifluoromethyl)phenyl]-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]quinolin-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/c2nc3ccccc3c(/C=C/C=C/c3ccc(N(C)C)cc3)c2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C41H35F6N3/c1-49(2)33-21-17-28(18-22-33)11-5-7-14-36-35-13-8-10-15-37(35)48-38(16-9-6-12-29-19-23-34(24-20-29)50(3)4)39(36)30-25-31(40(42,43)44)27-32(26-30)41(45,46)47/h5-27H,1-4H3/b11-5+,12-6+,14-7+,16-9+ |
| InChIKey | ZSZJYRDQITUTPK-CSIFGYIBSA-N |
| XLogP | 11.52 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|