C17H11NO5 — CID 35748607
(2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-3H-inden-1-one (PubChem CID 35748607) has the molecular formula C17H11NO5 and a molecular weight of 309.28 g/mol. Its IUPAC name is (2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-3H-inden-1-one.
| Compound Name | (2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 35748607 |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C/c2cc3c(cc2[N+](=O)[O-])OCO3)Cc2ccccc21 |
| InChI | InChI=1S/C17H11NO5/c19-17-12(5-10-3-1-2-4-13(10)17)6-11-7-15-16(23-9-22-15)8-14(11)18(20)21/h1-4,6-8H,5,9H2/b12-6+ |
| InChIKey | QVOOZENWKGAPOC-WUXMJOGZSA-N |
| XLogP | 3.15 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|