C18H15NO6 — CID 6214659
(3Z)-3-[(4,5-dimethoxy-2-nitrophenyl)methylidene]chromen-4-one (PubChem CID 6214659) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is (3Z)-3-[(4,5-dimethoxy-2-nitrophenyl)methylidene]chromen-4-one.
| Compound Name | (3Z)-3-[(4,5-dimethoxy-2-nitrophenyl)methylidene]chromen-4-one |
|---|---|
| PubChem CID | 6214659 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (3Z)-3-[(4,5-dimethoxy-2-nitrophenyl)methylidene]chromen-4-one |
| SMILES | COc1cc(/C=C2/COc3ccccc3C2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H15NO6/c1-23-16-8-11(14(19(21)22)9-17(16)24-2)7-12-10-25-15-6-4-3-5-13(15)18(12)20/h3-9H,10H2,1-2H3/b12-7- |
| InChIKey | UJLFBJMRSMEVCE-GHXNOFRVSA-N |
| XLogP | 3.27 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|