C18H11NO8 — CID 1348305
5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 1348305) has the molecular formula C18H11NO8 and a molecular weight of 369.29 g/mol. Its IUPAC name is 5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 1348305 |
| Molecular Formula | C18H11NO8 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | O=C1OC(c2ccccc2)OC(=O)C1=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C18H11NO8/c20-16-12(17(21)27-18(26-16)10-4-2-1-3-5-10)6-11-7-14-15(25-9-24-14)8-13(11)19(22)23/h1-8,18H,9H2/b12-6- |
| InChIKey | MONWEWUWDAIFQV-SDQBBNPISA-N |
| XLogP | 2.51 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|