C17H11BrO4 — CID 24583148
(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-4-hydroxy-3H-inden-1-one (PubChem CID 24583148) has the molecular formula C17H11BrO4 and a molecular weight of 359.18 g/mol. Its IUPAC name is (2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-4-hydroxy-3H-inden-1-one.
| Compound Name | (2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-4-hydroxy-3H-inden-1-one |
|---|---|
| PubChem CID | 24583148 |
| Molecular Formula | C17H11BrO4 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | (2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-4-hydroxy-3H-inden-1-one |
| SMILES | O=C1/C(=C\c2cc3c(cc2Br)OCO3)Cc2c(O)cccc21 |
| InChI | InChI=1S/C17H11BrO4/c18-13-7-16-15(21-8-22-16)6-9(13)4-10-5-12-11(17(10)20)2-1-3-14(12)19/h1-4,6-7,19H,5,8H2/b10-4- |
| InChIKey | BUUQOXGPKPJBQH-WMZJFQQLSA-N |
| XLogP | 3.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|