C22H17N3O4 — CID 9143128
2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 9143128) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9143128 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | Cc1cc(/C=N\N2C(=O)c3ccccc3C2=O)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H17N3O4/c1-13-9-15(11-23-25-21(26)17-5-3-4-6-18(17)22(25)27)14(2)24(13)16-7-8-19-20(10-16)29-12-28-19/h3-11H,12H2,1-2H3/b23-11- |
| InChIKey | BZDDJZKVBIMWEJ-KSEXSDGBSA-N |
| XLogP | 3.45 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|