C23H18N2O4S — CID 124583518
(5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 124583518) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is (5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124583518 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2\SC(=O)N(c3ccccc3)C2=O)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18N2O4S/c1-14-10-16(15(2)24(14)18-8-9-19-20(12-18)29-13-28-19)11-21-22(26)25(23(27)30-21)17-6-4-3-5-7-17/h3-12H,13H2,1-2H3/b21-11- |
| InChIKey | ADXONAKJRNVUNR-NHDPSOOVSA-N |
| XLogP | 5.06 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|