C20H18N2O6S — CID 1293695
methyl 2-[(5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 1293695) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1293695 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | methyl 2-[(5Z)-5-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C\c2cc(C)n(-c3ccc4c(c3)OCO4)c2C)C1=O |
| InChI | InChI=1S/C20H18N2O6S/c1-11-6-13(7-17-19(24)21(20(25)29-17)9-18(23)26-3)12(2)22(11)14-4-5-15-16(8-14)28-10-27-15/h4-8H,9-10H2,1-3H3/b17-7- |
| InChIKey | NJHLEEVSLFFZJL-IDUWFGFVSA-N |
| XLogP | 3.03 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|