C19H17ClN4O5 — CID 135788096
(5R)-3-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 135788096) has the molecular formula C19H17ClN4O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is (5R)-3-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135788096 |
| Molecular Formula | C19H17ClN4O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (5R)-3-[(E)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)C1=O |
| InChI | InChI=1S/C19H17ClN4O5/c1-19(8-7-12-5-3-2-4-6-12)17(26)23(18(27)22-19)21-11-13-9-14(20)10-15(16(13)25)24(28)29/h2-6,9-11,25H,7-8H2,1H3,(H,22,27)/b21-11+/t19-/m1/s1 |
| InChIKey | NNIVKLFYLWGSRF-GWJWUGQSSA-N |
| XLogP | 3.23 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|