C22H25N3O2 — CID 9349777
(5S)-5-methyl-5-(2-phenylethyl)-3-[(Z)-(4-propan-2-ylphenyl)methylideneamino]imidazolidine-2,4-dione (PubChem CID 9349777) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (5S)-5-methyl-5-(2-phenylethyl)-3-[(Z)-(4-propan-2-ylphenyl)methylideneamino]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-(2-phenylethyl)-3-[(Z)-(4-propan-2-ylphenyl)methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9349777 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (5S)-5-methyl-5-(2-phenylethyl)-3-[(Z)-(4-propan-2-ylphenyl)methylideneamino]imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(/C=N\N2C(=O)N[C@@](C)(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-16(2)19-11-9-18(10-12-19)15-23-25-20(26)22(3,24-21(25)27)14-13-17-7-5-4-6-8-17/h4-12,15-16H,13-14H2,1-3H3,(H,24,27)/b23-15-/t22-/m0/s1 |
| InChIKey | DQQHJOVFQPGGNY-PZLPMSIKSA-N |
| XLogP | 4.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|