C21H20N4O3 — CID 9349998
2-[4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]phenoxy]acetonitrile (PubChem CID 9349998) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 9349998 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]phenoxy]acetonitrile |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(/N=C\c2ccc(OCC#N)cc2)C1=O |
| InChI | InChI=1S/C21H20N4O3/c1-21(12-11-16-5-3-2-4-6-16)19(26)25(20(27)24-21)23-15-17-7-9-18(10-8-17)28-14-13-22/h2-10,15H,11-12,14H2,1H3,(H,24,27)/b23-15-/t21-/m1/s1 |
| InChIKey | IYCQLWKLLOWOFZ-FYYJVHHASA-N |
| XLogP | 2.87 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|