C19H17Cl2N3O2 — CID 9349724
(5S)-3-[(Z)-(2,3-dichlorophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 9349724) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is (5S)-3-[(Z)-(2,3-dichlorophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(Z)-(2,3-dichlorophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9349724 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (5S)-3-[(Z)-(2,3-dichlorophenyl)methylideneamino]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(/N=C\c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-19(11-10-13-6-3-2-4-7-13)17(25)24(18(26)23-19)22-12-14-8-5-9-15(20)16(14)21/h2-9,12H,10-11H2,1H3,(H,23,26)/b22-12-/t19-/m0/s1 |
| InChIKey | JPXDSBLLGWWCOW-ZIHVZMLCSA-N |
| XLogP | 4.27 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|