C20H19N4O6- — CID 9349944
2-methoxy-4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]-6-nitrophenolate (PubChem CID 9349944) has the molecular formula C20H19N4O6- and a molecular weight of 411.39 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]-6-nitrophenolate.
| Compound Name | 2-methoxy-4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 9349944 |
| Molecular Formula | C20H19N4O6- |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-methoxy-4-[(Z)-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]iminomethyl]-6-nitrophenolate |
| SMILES | COc1cc(/C=N\N2C(=O)N[C@](C)(CCc3ccccc3)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C20H20N4O6/c1-20(9-8-13-6-4-3-5-7-13)18(26)23(19(27)22-20)21-12-14-10-15(24(28)29)17(25)16(11-14)30-2/h3-7,10-12,25H,8-9H2,1-2H3,(H,22,27)/p-1/b21-12-/t20-/m1/s1 |
| InChIKey | DOQMIEFQQIIGQK-COVVZGLNSA-M |
| XLogP | 1.95 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|