C15H20N4OS — CID 135733381
3-tert-butyl-4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135733381) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-tert-butyl-4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-tert-butyl-4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135733381 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-tert-butyl-4-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(/C=N/n2c(C(C)(C)C)n[nH]c2=S)cc(C)c1O |
| InChI | InChI=1S/C15H20N4OS/c1-9-6-11(7-10(2)12(9)20)8-16-19-13(15(3,4)5)17-18-14(19)21/h6-8,20H,1-5H3,(H,18,21)/b16-8+ |
| InChIKey | ZJBYVNQVVAQRTN-LZYBPNLTSA-N |
| XLogP | 3.44 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|