C13H11BrN4O2S — CID 9357896
4-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione (PubChem CID 9357896) has the molecular formula C13H11BrN4O2S and a molecular weight of 367.23 g/mol. Its IUPAC name is 4-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9357896 |
| Molecular Formula | C13H11BrN4O2S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 4-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(C2CC2)n1/N=C\c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H11BrN4O2S/c14-9-3-7(4-10-11(9)20-6-19-10)5-15-18-12(8-1-2-8)16-17-13(18)21/h3-5,8H,1-2,6H2,(H,17,21)/b15-5- |
| InChIKey | BUCLZGDPHHKOQX-WCSRMQSCSA-N |
| XLogP | 3.19 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|