C15H15BrN4O5S — CID 136786839
3-[4-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 136786839) has the molecular formula C15H15BrN4O5S and a molecular weight of 443.28 g/mol. Its IUPAC name is 3-[4-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 136786839 |
| Molecular Formula | C15H15BrN4O5S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 3-[4-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | CCOc1cc(/C=N\n2c(=S)[nH]nc(CCC(=O)O)c2=O)cc(Br)c1O |
| InChI | InChI=1S/C15H15BrN4O5S/c1-2-25-11-6-8(5-9(16)13(11)23)7-17-20-14(24)10(3-4-12(21)22)18-19-15(20)26/h5-7,23H,2-4H2,1H3,(H,19,26)(H,21,22)/b17-7- |
| InChIKey | GZSYYBJTUPVUNI-IDUWFGFVSA-N |
| XLogP | 2.07 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|