C13H10Cl2N4O5S — CID 136786833
3-[4-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 136786833) has the molecular formula C13H10Cl2N4O5S and a molecular weight of 405.22 g/mol. Its IUPAC name is 3-[4-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 136786833 |
| Molecular Formula | C13H10Cl2N4O5S |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 3-[4-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | O=C(O)CCc1n[nH]c(=S)n(/N=C\c2cc(Cl)c(O)c(Cl)c2O)c1=O |
| InChI | InChI=1S/C13H10Cl2N4O5S/c14-6-3-5(10(22)9(15)11(6)23)4-16-19-12(24)7(1-2-8(20)21)17-18-13(19)25/h3-4,22-23H,1-2H2,(H,18,25)(H,20,21)/b16-4- |
| InChIKey | GSQCAQGRKVSBMU-XRVIQIRUSA-N |
| XLogP | 1.92 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|