C16H18N4O3S — CID 110508225
3-[5-oxo-4-[(Z)-(4-propan-2-ylphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 110508225) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[5-oxo-4-[(Z)-(4-propan-2-ylphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[5-oxo-4-[(Z)-(4-propan-2-ylphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 110508225 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[5-oxo-4-[(Z)-(4-propan-2-ylphenyl)methylideneamino]-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | CC(C)c1ccc(/C=N\n2c(=S)[nH]nc(CCC(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C16H18N4O3S/c1-10(2)12-5-3-11(4-6-12)9-17-20-15(23)13(7-8-14(21)22)18-19-16(20)24/h3-6,9-10H,7-8H2,1-2H3,(H,19,24)(H,21,22)/b17-9- |
| InChIKey | LGDMFIUXTGPBBR-MFOYZWKCSA-N |
| XLogP | 2.32 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|