C17H17N5S — CID 6859367
4-[(E)-(4-propan-2-ylphenyl)methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 6859367) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 4-[(E)-(4-propan-2-ylphenyl)methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(4-propan-2-ylphenyl)methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6859367 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-[(E)-(4-propan-2-ylphenyl)methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)c1ccc(/C=N/n2c(-c3ccccn3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H17N5S/c1-12(2)14-8-6-13(7-9-14)11-19-22-16(20-21-17(22)23)15-5-3-4-10-18-15/h3-12H,1-2H3,(H,21,23)/b19-11+ |
| InChIKey | DPVPIXBMDNZJAR-YBFXNURJSA-N |
| XLogP | 4.01 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|