C14H11N5S — CID 6858358
4-[(E)-benzylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 6858358) has the molecular formula C14H11N5S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-[(E)-benzylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-benzylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6858358 |
| Molecular Formula | C14H11N5S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[(E)-benzylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccccn2)n1/N=C/c1ccccc1 |
| InChI | InChI=1S/C14H11N5S/c20-14-18-17-13(12-8-4-5-9-15-12)19(14)16-10-11-6-2-1-3-7-11/h1-10H,(H,18,20)/b16-10+ |
| InChIKey | GALNGBXIGPDSLA-MHWRWJLKSA-N |
| XLogP | 2.88 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|