C14H13BrN4O4S — CID 110508084
3-[4-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 110508084) has the molecular formula C14H13BrN4O4S and a molecular weight of 413.25 g/mol. Its IUPAC name is 3-[4-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 110508084 |
| Molecular Formula | C14H13BrN4O4S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 3-[4-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | COc1ccc(/C=N\n2c(=S)[nH]nc(CCC(=O)O)c2=O)cc1Br |
| InChI | InChI=1S/C14H13BrN4O4S/c1-23-11-4-2-8(6-9(11)15)7-16-19-13(22)10(3-5-12(20)21)17-18-14(19)24/h2,4,6-7H,3,5H2,1H3,(H,18,24)(H,20,21)/b16-7- |
| InChIKey | RZBHASFHBXMEQI-APSNUPSMSA-N |
| XLogP | 1.97 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|