C13H12N4O4S — CID 136786815
3-[4-[(Z)-(2-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 136786815) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is 3-[4-[(Z)-(2-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-(2-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 136786815 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-[4-[(Z)-(2-hydroxyphenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | O=C(O)CCc1n[nH]c(=S)n(/N=C\c2ccccc2O)c1=O |
| InChI | InChI=1S/C13H12N4O4S/c18-10-4-2-1-3-8(10)7-14-17-12(21)9(5-6-11(19)20)15-16-13(17)22/h1-4,7,18H,5-6H2,(H,16,22)(H,19,20)/b14-7- |
| InChIKey | ZYAICQSOIBEBIU-AUWJEWJLSA-N |
| XLogP | 0.91 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|