C20H24N4O5S — CID 110508134
3-[4-[(Z)-[2-(2-hexoxyphenyl)-2-oxoethylidene]amino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid (PubChem CID 110508134) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[4-[(Z)-[2-(2-hexoxyphenyl)-2-oxoethylidene]amino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-[2-(2-hexoxyphenyl)-2-oxoethylidene]amino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 110508134 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[4-[(Z)-[2-(2-hexoxyphenyl)-2-oxoethylidene]amino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| SMILES | CCCCCCOc1ccccc1C(=O)/C=N\n1c(=S)[nH]nc(CCC(=O)O)c1=O |
| InChI | InChI=1S/C20H24N4O5S/c1-2-3-4-7-12-29-17-9-6-5-8-14(17)16(25)13-21-24-19(28)15(10-11-18(26)27)22-23-20(24)30/h5-6,8-9,13H,2-4,7,10-12H2,1H3,(H,23,30)(H,26,27)/b21-13- |
| InChIKey | NAWXEDFBLUIICH-BKUYFWCQSA-N |
| XLogP | 2.99 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|