C20H19N4O3S- — CID 8865001
4-[(Z)-[3-[(4-propan-2-ylphenoxy)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate (PubChem CID 8865001) has the molecular formula C20H19N4O3S- and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[(Z)-[3-[(4-propan-2-ylphenoxy)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate.
| Compound Name | 4-[(Z)-[3-[(4-propan-2-ylphenoxy)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 8865001 |
| Molecular Formula | C20H19N4O3S- |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[(Z)-[3-[(4-propan-2-ylphenoxy)methyl]-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]benzoate |
| SMILES | CC(C)c1ccc(OCc2n[nH]c(=S)n2/N=C\c2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-13(2)15-7-9-17(10-8-15)27-12-18-22-23-20(28)24(18)21-11-14-3-5-16(6-4-14)19(25)26/h3-11,13H,12H2,1-2H3,(H,23,28)(H,25,26)/p-1/b21-11- |
| InChIKey | VFPXDTGBNACOSP-NHDPSOOVSA-M |
| XLogP | 2.89 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|