C19H23N4O3S- — CID 9293660
2-[4-[(Z)-[3-(2-cyclohexylethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate (PubChem CID 9293660) has the molecular formula C19H23N4O3S- and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-(2-cyclohexylethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-[3-(2-cyclohexylethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9293660 |
| Molecular Formula | C19H23N4O3S- |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[4-[(Z)-[3-(2-cyclohexylethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=N\n2c(CCC3CCCCC3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C19H24N4O3S/c24-18(25)13-26-16-9-6-15(7-10-16)12-20-23-17(21-22-19(23)27)11-8-14-4-2-1-3-5-14/h6-7,9-10,12,14H,1-5,8,11,13H2,(H,22,27)(H,24,25)/p-1/b20-12- |
| InChIKey | SXMPBXPZMOKDKO-NDENLUEZSA-M |
| XLogP | 2.46 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|