C17H22N4O3S — CID 146129374
3-(2-cyclohexylethyl)-4-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 146129374) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-4-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-cyclohexylethyl)-4-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 146129374 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-(2-cyclohexylethyl)-4-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc(/C=N/n2c(CCC3CCCCC3)n[nH]c2=S)c(O)c1O |
| InChI | InChI=1S/C17H22N4O3S/c22-13-8-7-12(15(23)16(13)24)10-18-21-14(19-20-17(21)25)9-6-11-4-2-1-3-5-11/h7-8,10-11,22-24H,1-6,9H2,(H,20,25)/b18-10+ |
| InChIKey | VHQWDSASABGXSJ-VCHYOVAHSA-N |
| XLogP | 3.45 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|