C20H26F2N4O2S — CID 9293782
3-(2-cyclohexylethyl)-4-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9293782) has the molecular formula C20H26F2N4O2S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-4-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-cyclohexylethyl)-4-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9293782 |
| Molecular Formula | C20H26F2N4O2S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-(2-cyclohexylethyl)-4-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(/C=N\n2c(CCC3CCCCC3)n[nH]c2=S)ccc1OC(F)F |
| InChI | InChI=1S/C20H26F2N4O2S/c1-2-27-17-12-15(8-10-16(17)28-19(21)22)13-23-26-18(24-25-20(26)29)11-9-14-6-4-3-5-7-14/h8,10,12-14,19H,2-7,9,11H2,1H3,(H,25,29)/b23-13- |
| InChIKey | GAHXVZCFAZHHBC-QRVIBDJDSA-N |
| XLogP | 5.34 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|