C20H26N6S2 — CID 9293803
3-(2-cyclohexylethyl)-4-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9293803) has the molecular formula C20H26N6S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-4-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-cyclohexylethyl)-4-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9293803 |
| Molecular Formula | C20H26N6S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-(2-cyclohexylethyl)-4-[(Z)-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(/C=N\n2c(CCC3CCCCC3)n[nH]c2=S)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C20H26N6S2/c1-14-12-17(15(2)25(14)20-21-10-11-28-20)13-22-26-18(23-24-19(26)27)9-8-16-6-4-3-5-7-16/h10-13,16H,3-9H2,1-2H3,(H,24,27)/b22-13- |
| InChIKey | HOCPOAKWVSDLCD-XKZIYDEJSA-N |
| XLogP | 5.20 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|