C23H29Br2N7O — CID 3632135
N-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 3632135) has the molecular formula C23H29Br2N7O and a molecular weight of 579.34 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3632135 |
| Molecular Formula | C23H29Br2N7O |
| Molecular Weight | 579.34 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | N-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C=CCOc1c(Br)cc(C=NNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1Br |
| InChI | InChI=1S/C23H29Br2N7O/c1-2-13-33-20-18(24)14-17(15-19(20)25)16-26-30-21-27-22(31-9-5-3-6-10-31)29-23(28-21)32-11-7-4-8-12-32/h2,14-16H,1,3-13H2,(H,27,28,29,30) |
| InChIKey | NLXFXURPGNFIHB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|