C18H19Br2NO — CID 126217272
1-(3,5-dibromo-4-propoxyphenyl)-N-(4-ethylphenyl)methanimine (PubChem CID 126217272) has the molecular formula C18H19Br2NO and a molecular weight of 425.16 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-propoxyphenyl)-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-(3,5-dibromo-4-propoxyphenyl)-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 126217272 |
| Molecular Formula | C18H19Br2NO |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 1-(3,5-dibromo-4-propoxyphenyl)-N-(4-ethylphenyl)methanimine |
| SMILES | CCCOc1c(Br)cc(/C=N/c2ccc(CC)cc2)cc1Br |
| InChI | InChI=1S/C18H19Br2NO/c1-3-9-22-18-16(19)10-14(11-17(18)20)12-21-15-7-5-13(4-2)6-8-15/h5-8,10-12H,3-4,9H2,1-2H3/b21-12+ |
| InChIKey | KLLQWXZOGGTWKA-CIAFOILYSA-N |
| XLogP | 6.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|