C15H13BrINO2 — CID 1272173
1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-iodophenyl)methanimine (PubChem CID 1272173) has the molecular formula C15H13BrINO2 and a molecular weight of 446.08 g/mol. Its IUPAC name is 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-iodophenyl)methanimine.
| Compound Name | 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-iodophenyl)methanimine |
|---|---|
| PubChem CID | 1272173 |
| Molecular Formula | C15H13BrINO2 |
| Molecular Weight | 446.08 g/mol |
| Exact Mass | 444.92 |
| IUPAC Name | 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-iodophenyl)methanimine |
| SMILES | COc1cc(OC)c(/C=N/c2ccc(I)cc2)cc1Br |
| InChI | InChI=1S/C15H13BrINO2/c1-19-14-8-15(20-2)13(16)7-10(14)9-18-12-5-3-11(17)4-6-12/h3-9H,1-2H3/b18-9+ |
| InChIKey | ONZREYPPCOPHOJ-GIJQJNRQSA-N |
| XLogP | 4.82 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.08 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|