C16H16INO2 — CID 102419767
1-(2-iodo-4,5-dimethoxyphenyl)-N-(4-methylphenyl)methanimine (PubChem CID 102419767) has the molecular formula C16H16INO2 and a molecular weight of 381.21 g/mol. Its IUPAC name is 1-(2-iodo-4,5-dimethoxyphenyl)-N-(4-methylphenyl)methanimine.
| Compound Name | 1-(2-iodo-4,5-dimethoxyphenyl)-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 102419767 |
| Molecular Formula | C16H16INO2 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 1-(2-iodo-4,5-dimethoxyphenyl)-N-(4-methylphenyl)methanimine |
| SMILES | COc1cc(I)c(/C=N/c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C16H16INO2/c1-11-4-6-13(7-5-11)18-10-12-8-15(19-2)16(20-3)9-14(12)17/h4-10H,1-3H3/b18-10+ |
| InChIKey | WYUDBZZOXWOAQA-VCHYOVAHSA-N |
| XLogP | 4.37 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|