C19H21BrN2O3 — CID 170896471
1-[3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-2-(dimethylamino)ethanone (PubChem CID 170896471) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is 1-[3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 170896471 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-[3-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-2-(dimethylamino)ethanone |
| SMILES | COc1cc(OC)c(/C=N/c2cccc(C(=O)CN(C)C)c2)cc1Br |
| InChI | InChI=1S/C19H21BrN2O3/c1-22(2)12-17(23)13-6-5-7-15(8-13)21-11-14-9-16(20)19(25-4)10-18(14)24-3/h5-11H,12H2,1-4H3/b21-11+ |
| InChIKey | IKMQNYQHERSNMU-SRZZPIQSSA-N |
| XLogP | 3.96 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|