C15H13BrN4O5 — CID 5056187
[5-bromo-2-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 5056187) has the molecular formula C15H13BrN4O5 and a molecular weight of 409.20 g/mol. Its IUPAC name is [5-bromo-2-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [5-bromo-2-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 5056187 |
| Molecular Formula | C15H13BrN4O5 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [5-bromo-2-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cn2)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C15H13BrN4O5/c1-9(21)25-14-6-12(16)10(5-13(14)24-2)7-18-19-15-4-3-11(8-17-15)20(22)23/h3-8H,1-2H3,(H,17,19) |
| InChIKey | LFMDUSXICIOTRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|