C20H19N5O5 — CID 7765817
2-[2-methoxy-6-[(Z)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 7765817) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-[2-methoxy-6-[(Z)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-6-[(Z)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 7765817 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[2-methoxy-6-[(Z)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccccc1-c1cnnc(N/N=C\c2cccc(OC)c2OCC(=O)O)n1 |
| InChI | InChI=1S/C20H19N5O5/c1-28-16-8-4-3-7-14(16)15-11-22-25-20(23-15)24-21-10-13-6-5-9-17(29-2)19(13)30-12-18(26)27/h3-11H,12H2,1-2H3,(H,26,27)(H,23,24,25)/b21-10- |
| InChIKey | MCOHNQUFTNFFAK-FBHDLOMBSA-N |
| XLogP | 2.47 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|