C24H33N7O4 — CID 126220104
2-[2-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126220104) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[2-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126220104 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-[2-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cccc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1OCC(=O)O |
| InChI | InChI=1S/C24H33N7O4/c1-2-34-19-11-9-10-18(21(19)35-17-20(32)33)16-25-29-22-26-23(30-12-5-3-6-13-30)28-24(27-22)31-14-7-4-8-15-31/h9-11,16H,2-8,12-15,17H2,1H3,(H,32,33)(H,26,27,28,29)/b25-16+ |
| InChIKey | VDRMNGUGJANSFF-PCLIKHOPSA-N |
| XLogP | 3.16 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|