C20H25N7O5 — CID 4767404
2-[2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 4767404) has the molecular formula C20H25N7O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4767404 |
| Molecular Formula | C20H25N7O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[2-[[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=NNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25N7O5/c28-17(29)14-32-16-4-2-1-3-15(16)13-21-25-18-22-19(26-5-9-30-10-6-26)24-20(23-18)27-7-11-31-12-8-27/h1-4,13H,5-12,14H2,(H,28,29)(H,22,23,24,25) |
| InChIKey | JXMDFPAOSYRHPI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|