C23H22N6O — CID 9013569
N-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 9013569) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 9013569 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)cc1/C=N\Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C23H22N6O/c1-16-13-17(2)26-23(25-16)27-24-14-18-15-29(19-9-5-4-6-10-19)28-22(18)20-11-7-8-12-21(20)30-3/h4-15H,1-3H3,(H,25,26,27)/b24-14- |
| InChIKey | LPOQHDGUVHYYDR-OYKKKHCWSA-N |
| XLogP | 4.40 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|