C19H19N5OS — CID 9071653
1-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methylthiourea (PubChem CID 9071653) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 9071653 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[(Z)-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1OC |
| InChI | InChI=1S/C19H19N5OS/c1-20-19(26)22-21-12-14-13-24(15-8-4-3-5-9-15)23-18(14)16-10-6-7-11-17(16)25-2/h3-13H,1-2H3,(H2,20,22,26)/b21-12- |
| InChIKey | CCKWPDGQGOOCCS-MTJSOVHGSA-N |
| XLogP | 2.98 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|