C20H18N6S — CID 5344334
[(E)-[3-(1-methylindol-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea (PubChem CID 5344334) has the molecular formula C20H18N6S and a molecular weight of 374.47 g/mol. Its IUPAC name is [(E)-[3-(1-methylindol-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[3-(1-methylindol-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 5344334 |
| Molecular Formula | C20H18N6S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(E)-[3-(1-methylindol-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| SMILES | Cn1cc(-c2nn(-c3ccccc3)cc2/C=N/NC(N)=S)c2ccccc21 |
| InChI | InChI=1S/C20H18N6S/c1-25-13-17(16-9-5-6-10-18(16)25)19-14(11-22-23-20(21)27)12-26(24-19)15-7-3-2-4-8-15/h2-13H,1H3,(H3,21,23,27)/b22-11+ |
| InChIKey | LFFFLFFNQAENNC-SSDVNMTOSA-N |
| XLogP | 3.20 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|