C20H22N6OS — CID 8979878
1-[(2S)-1-methoxypropan-2-yl]-3-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]thiourea (PubChem CID 8979878) has the molecular formula C20H22N6OS and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[(2S)-1-methoxypropan-2-yl]-3-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]thiourea.
| Compound Name | 1-[(2S)-1-methoxypropan-2-yl]-3-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 8979878 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[(2S)-1-methoxypropan-2-yl]-3-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]thiourea |
| SMILES | COC[C@H](C)NC(=S)N/N=C\c1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C20H22N6OS/c1-15(14-27-2)23-20(28)24-22-12-17-13-26(18-6-4-3-5-7-18)25-19(17)16-8-10-21-11-9-16/h3-13,15H,14H2,1-2H3,(H2,23,24,28)/b22-12-/t15-/m0/s1 |
| InChIKey | AMXXVSXPSTZWRD-QZDMBBGESA-N |
| XLogP | 2.77 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|