C14H18N8 — CID 2334192
N-[2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]ethylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 2334192) has the molecular formula C14H18N8 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]ethylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]ethylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 2334192 |
| Molecular Formula | C14H18N8 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]ethylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NN=CC=NNc2nc(C)cc(C)n2)n1 |
| InChI | InChI=1S/C14H18N8/c1-9-7-10(2)18-13(17-9)21-15-5-6-16-22-14-19-11(3)8-12(4)20-14/h5-8H,1-4H3,(H,17,18,21)(H,19,20,22) |
| InChIKey | CXGSASHVRMSRPX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|