C11H9Br2N5O2 — CID 136853969
5-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one (PubChem CID 136853969) has the molecular formula C11H9Br2N5O2 and a molecular weight of 403.03 g/mol. Its IUPAC name is 5-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 136853969 |
| Molecular Formula | C11H9Br2N5O2 |
| Molecular Weight | 403.03 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 5-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-6-methyl-2H-1,2,4-triazin-3-one |
| SMILES | Cc1n[nH]c(=O)nc1N/N=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H9Br2N5O2/c1-5-10(15-11(20)18-16-5)17-14-4-6-2-7(12)9(19)8(13)3-6/h2-4,19H,1H3,(H2,15,17,18,20)/b14-4- |
| InChIKey | NKJOMANULUNTAU-CPSFFCFKSA-N |
| XLogP | 2.15 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.03 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|