C18H13ClN2O4 — CID 71901989
3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 71901989) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 71901989 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Cl)c2c(c1)OCCCO2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13ClN2O4/c19-16-9-12(10-17-18(16)25-7-1-6-24-17)8-14(11-20)13-2-4-15(5-3-13)21(22)23/h2-5,8-10H,1,6-7H2 |
| InChIKey | LGZTXUDDLWMJSQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|