C31H20N4O7S3 — CID 177414360
[2,6-bis[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-4-methylphenyl] 2,4-dinitrobenzenesulfonate (PubChem CID 177414360) has the molecular formula C31H20N4O7S3 and a molecular weight of 656.72 g/mol. Its IUPAC name is [2,6-bis[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-4-methylphenyl] 2,4-dinitrobenzenesulfonate.
| Compound Name | [2,6-bis[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-4-methylphenyl] 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 177414360 |
| Molecular Formula | C31H20N4O7S3 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | [2,6-bis[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-4-methylphenyl] 2,4-dinitrobenzenesulfonate |
| SMILES | Cc1cc(/C=C/c2nc3ccccc3s2)c(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(/C=C/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C31H20N4O7S3/c1-19-16-20(10-14-29-32-23-6-2-4-8-26(23)43-29)31(21(17-19)11-15-30-33-24-7-3-5-9-27(24)44-30)42-45(40,41)28-13-12-22(34(36)37)18-25(28)35(38)39/h2-18H,1H3/b14-10+,15-11+ |
| InChIKey | IUYFHEOEJHWLKK-WFYKWJGLSA-N |
| XLogP | 8.14 |
| TPSA | 155.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|